C19H17FN2O3 — CID 167977206
3-(4-fluorophenyl)-3-[(1-methylindole-2-carbonyl)amino]propanoic acid (PubChem CID 167977206) has the molecular formula C19H17FN2O3 and a molecular weight of 340.35 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-3-[(1-methylindole-2-carbonyl)amino]propanoic acid.
| Compound Name | 3-(4-fluorophenyl)-3-[(1-methylindole-2-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 167977206 |
| Molecular Formula | C19H17FN2O3 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 3-(4-fluorophenyl)-3-[(1-methylindole-2-carbonyl)amino]propanoic acid |
| SMILES | Cn1c(C(=O)NC(CC(=O)O)c2ccc(F)cc2)cc2ccccc21 |
| InChI | InChI=1S/C19H17FN2O3/c1-22-16-5-3-2-4-13(16)10-17(22)19(25)21-15(11-18(23)24)12-6-8-14(20)9-7-12/h2-10,15H,11H2,1H3,(H,21,25)(H,23,24) |
| InChIKey | AGXDQLJNSWOVLJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |