C19H19N3O2 — CID 55876077
N'-(4-ethylbenzoyl)-1-methylindole-2-carbohydrazide (PubChem CID 55876077) has the molecular formula C19H19N3O2 and a molecular weight of 321.38 g/mol. Its IUPAC name is N'-(4-ethylbenzoyl)-1-methylindole-2-carbohydrazide.
| Compound Name | N'-(4-ethylbenzoyl)-1-methylindole-2-carbohydrazide |
|---|---|
| PubChem CID | 55876077 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | N'-(4-ethylbenzoyl)-1-methylindole-2-carbohydrazide |
| SMILES | CCc1ccc(C(=O)NNC(=O)c2cc3ccccc3n2C)cc1 |
| InChI | InChI=1S/C19H19N3O2/c1-3-13-8-10-14(11-9-13)18(23)20-21-19(24)17-12-15-6-4-5-7-16(15)22(17)2/h4-12H,3H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | ROZDKZPYXMEWCR-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|