C32H29N3O5S — CID 11421699
4-[(E)-3-[2,4-dimethoxy-5-(1-methylindol-2-yl)phenyl]prop-2-enoyl]-N-(pyridin-3-ylmethyl)benzenesulfonamide (PubChem CID 11421699) has the molecular formula C32H29N3O5S and a molecular weight of 567.67 g/mol. Its IUPAC name is 4-[(E)-3-[2,4-dimethoxy-5-(1-methylindol-2-yl)phenyl]prop-2-enoyl]-N-(pyridin-3-ylmethyl)benzenesulfonamide.
| Compound Name | 4-[(E)-3-[2,4-dimethoxy-5-(1-methylindol-2-yl)phenyl]prop-2-enoyl]-N-(pyridin-3-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 11421699 |
| Molecular Formula | C32H29N3O5S |
| Molecular Weight | 567.67 g/mol |
| Exact Mass | 567.18 |
| IUPAC Name | 4-[(E)-3-[2,4-dimethoxy-5-(1-methylindol-2-yl)phenyl]prop-2-enoyl]-N-(pyridin-3-ylmethyl)benzenesulfonamide |
| SMILES | COc1cc(OC)c(-c2cc3ccccc3n2C)cc1/C=C/C(=O)c1ccc(S(=O)(=O)NCc2cccnc2)cc1 |
| InChI | InChI=1S/C32H29N3O5S/c1-35-28-9-5-4-8-24(28)18-29(35)27-17-25(31(39-2)19-32(27)40-3)12-15-30(36)23-10-13-26(14-11-23)41(37,38)34-21-22-7-6-16-33-20-22/h4-20,34H,21H2,1-3H3/b15-12+ |
| InChIKey | MJZOJSAZGVEAAF-NTCAYCPXSA-N |
| XLogP | 5.63 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.67 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|