C29H28N2NaO6S — CID 172861322
CID 172861322 (PubChem CID 172861322) has the molecular formula C29H28N2NaO6S and a molecular weight of 555.61 g/mol.
| Compound Name | CID 172861322 |
|---|---|
| PubChem CID | 172861322 |
| Molecular Formula | C29H28N2NaO6S |
| Molecular Weight | 555.61 g/mol |
| Exact Mass | 555.16 |
| IUPAC Name | — |
| SMILES | COc1cc(OC)c(-c2cc3ccccc3[nH]2)cc1/C=C/C(=O)c1ccc(S(=O)(=O)NC(=O)C(C)C)cc1.[Na] |
| InChI | InChI=1S/C29H28N2O6S.Na/c1-18(2)29(33)31-38(34,35)22-12-9-19(10-13-22)26(32)14-11-21-15-23(28(37-4)17-27(21)36-3)25-16-20-7-5-6-8-24(20)30-25;/h5-18,30H,1-4H3,(H,31,33);/b14-11+; |
| InChIKey | ZJVLNHDHXAXRHS-JHGYPSGKSA-N |
| XLogP | 4.83 |
| TPSA | 114.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.61 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|