About CID 69490416
CID 69490416 (PubChem CID 69490416) has the molecular formula C28H26KN2O7S
and a molecular weight of 573.69 g/mol.
Molecular Properties
| Compound Name | CID 69490416 |
| PubChem CID | 69490416 |
| Molecular Formula | C28H26KN2O7S |
| Molecular Weight | 573.69 g/mol |
| Exact Mass | 573.11 |
| IUPAC Name | — |
| SMILES | CCOC(=O)NS(=O)(=O)c1ccc(C(=O)C=Cc2cc(-c3cc4ccccc4[nH]3)c(OC)cc2OC)cc1.[K] |
| InChI | InChI=1S/C28H26N2O7S.K/c1-4-37-28(32)30-38(33,34)21-12-9-18(10-13-21)25(31)14-11-20-15-22(27(36-3)17-26(20)35-2)24-16-19-7-5-6-8-23(19)29-24;/h5-17,29H,4H2,1-3H3,(H,30,32); |
| InChIKey | LAXQIPCLIMDMGR-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 123.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 573.69 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 69490416 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 69490416?
The IUPAC name of CID 69490416 (CID 69490416) is not available.
What is the SMILES notation for CID 69490416?
The canonical SMILES for CID 69490416 is CCOC(=O)NS(=O)(=O)c1ccc(C(=O)C=Cc2cc(-c3cc4ccccc4[nH]3)c(OC)cc2OC)cc1.[K].
What is the InChIKey of CID 69490416?
The InChIKey is LAXQIPCLIMDMGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H26N2O7S.K/c1-4-37-28(32)30-38(33,34)21-12-9-18(10-13-21)25(31)14-11-20-15-22(27(36-3)17-26(20)35-2)24-16-19-7-5-6-8-23(19)29-24;/h5-17,29H,4H2,1-3H3,(H,30,32);.
What are the key properties of CID 69490416?
CID 69490416 has a molecular weight of 573.69 g/mol, XLogP of 4.80, 9 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 69490416 is sourced from PubChem (CID 69490416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).