C28H26KN2O7S — CID 69490416
CID 69490416 (PubChem CID 69490416) has the molecular formula C28H26KN2O7S and a molecular weight of 573.69 g/mol.
| Compound Name | CID 69490416 |
|---|---|
| PubChem CID | 69490416 |
| Molecular Formula | C28H26KN2O7S |
| Molecular Weight | 573.69 g/mol |
| Exact Mass | 573.11 |
| IUPAC Name | — |
| SMILES | CCOC(=O)NS(=O)(=O)c1ccc(C(=O)C=Cc2cc(-c3cc4ccccc4[nH]3)c(OC)cc2OC)cc1.[K] |
| InChI | InChI=1S/C28H26N2O7S.K/c1-4-37-28(32)30-38(33,34)21-12-9-18(10-13-21)25(31)14-11-20-15-22(27(36-3)17-26(20)35-2)24-16-19-7-5-6-8-23(19)29-24;/h5-17,29H,4H2,1-3H3,(H,30,32); |
| InChIKey | LAXQIPCLIMDMGR-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 123.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.69 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|