C29H27N2O6S- — CID 58800224
(1Z)-N-[4-[(E)-3-[5-(1H-indol-2-yl)-2,4-dimethoxyphenyl]prop-2-enoyl]phenyl]sulfonyl-2-methylpropanimidate (PubChem CID 58800224) has the molecular formula C29H27N2O6S- and a molecular weight of 531.61 g/mol. Its IUPAC name is (1Z)-N-[4-[(E)-3-[5-(1H-indol-2-yl)-2,4-dimethoxyphenyl]prop-2-enoyl]phenyl]sulfonyl-2-methylpropanimidate.
| Compound Name | (1Z)-N-[4-[(E)-3-[5-(1H-indol-2-yl)-2,4-dimethoxyphenyl]prop-2-enoyl]phenyl]sulfonyl-2-methylpropanimidate |
|---|---|
| PubChem CID | 58800224 |
| Molecular Formula | C29H27N2O6S- |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.16 |
| IUPAC Name | (1Z)-N-[4-[(E)-3-[5-(1H-indol-2-yl)-2,4-dimethoxyphenyl]prop-2-enoyl]phenyl]sulfonyl-2-methylpropanimidate |
| SMILES | COc1cc(OC)c(-c2cc3ccccc3[nH]2)cc1/C=C/C(=O)c1ccc(S(=O)(=O)/N=C(\[O-])C(C)C)cc1 |
| InChI | InChI=1S/C29H28N2O6S/c1-18(2)29(33)31-38(34,35)22-12-9-19(10-13-22)26(32)14-11-21-15-23(28(37-4)17-27(21)36-3)25-16-20-7-5-6-8-24(20)30-25/h5-18,30H,1-4H3,(H,31,33)/p-1/b14-11+ |
| InChIKey | OPXJJOSUSMVZDL-SDNWHVSQSA-M |
| XLogP | 4.85 |
| TPSA | 120.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|