C30H30N2O7S — CID 174463016
4-[(E)-3-[5-(7-azatricyclo[4.3.0.07,9]nona-1,3,5,8-tetraen-8-yl)-2,4-dimethoxyphenyl]prop-2-enoyl]benzenesulfonamide;tert-butyl formate (PubChem CID 174463016) has the molecular formula C30H30N2O7S and a molecular weight of 562.64 g/mol. Its IUPAC name is 4-[(E)-3-[5-(7-azatricyclo[4.3.0.07,9]nona-1,3,5,8-tetraen-8-yl)-2,4-dimethoxyphenyl]prop-2-enoyl]benzenesulfonamide;tert-butyl formate.
| Compound Name | 4-[(E)-3-[5-(7-azatricyclo[4.3.0.07,9]nona-1,3,5,8-tetraen-8-yl)-2,4-dimethoxyphenyl]prop-2-enoyl]benzenesulfonamide;tert-butyl formate |
|---|---|
| PubChem CID | 174463016 |
| Molecular Formula | C30H30N2O7S |
| Molecular Weight | 562.64 g/mol |
| Exact Mass | 562.18 |
| IUPAC Name | 4-[(E)-3-[5-(7-azatricyclo[4.3.0.07,9]nona-1,3,5,8-tetraen-8-yl)-2,4-dimethoxyphenyl]prop-2-enoyl]benzenesulfonamide;tert-butyl formate |
| SMILES | CC(C)(C)OC=O.COc1cc(OC)c(-c2c3c4ccccc4n2-3)cc1/C=C/C(=O)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C25H20N2O5S.C5H10O2/c1-31-22-14-23(32-2)19(25-24-18-5-3-4-6-20(18)27(24)25)13-16(22)9-12-21(28)15-7-10-17(11-8-15)33(26,29)30;1-5(2,3)7-4-6/h3-14H,1-2H3,(H2,26,29,30);4H,1-3H3/b12-9+; |
| InChIKey | JNIUBUDBDWMGSP-NBYYMMLRSA-N |
| XLogP | 5.13 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.64 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|