C27H19NO6S — CID 10299780
2-[4-(1-benzothiophen-2-yl)-2-[(E)-3-(1,3-benzoxazol-7-yl)-3-oxoprop-1-enyl]-5-methoxyphenoxy]acetic acid (PubChem CID 10299780) has the molecular formula C27H19NO6S and a molecular weight of 485.52 g/mol. Its IUPAC name is 2-[4-(1-benzothiophen-2-yl)-2-[(E)-3-(1,3-benzoxazol-7-yl)-3-oxoprop-1-enyl]-5-methoxyphenoxy]acetic acid.
| Compound Name | 2-[4-(1-benzothiophen-2-yl)-2-[(E)-3-(1,3-benzoxazol-7-yl)-3-oxoprop-1-enyl]-5-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 10299780 |
| Molecular Formula | C27H19NO6S |
| Molecular Weight | 485.52 g/mol |
| Exact Mass | 485.09 |
| IUPAC Name | 2-[4-(1-benzothiophen-2-yl)-2-[(E)-3-(1,3-benzoxazol-7-yl)-3-oxoprop-1-enyl]-5-methoxyphenoxy]acetic acid |
| SMILES | COc1cc(OCC(=O)O)c(/C=C/C(=O)c2cccc3ncoc23)cc1-c1cc2ccccc2s1 |
| InChI | InChI=1S/C27H19NO6S/c1-32-23-13-22(33-14-26(30)31)16(11-19(23)25-12-17-5-2-3-8-24(17)35-25)9-10-21(29)18-6-4-7-20-27(18)34-15-28-20/h2-13,15H,14H2,1H3,(H,30,31)/b10-9+ |
| InChIKey | ADOIJPFZVAWMBB-MDZDMXLPSA-N |
| XLogP | 6.08 |
| TPSA | 98.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.52 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|