C26H22O5S — CID 142235656
(E)-3-[5-(1-benzothiophen-2-yl)-4-hydroxy-2-methoxyphenyl]-1-(3,5-dimethoxyphenyl)prop-2-en-1-one (PubChem CID 142235656) has the molecular formula C26H22O5S and a molecular weight of 446.52 g/mol. Its IUPAC name is (E)-3-[5-(1-benzothiophen-2-yl)-4-hydroxy-2-methoxyphenyl]-1-(3,5-dimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[5-(1-benzothiophen-2-yl)-4-hydroxy-2-methoxyphenyl]-1-(3,5-dimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 142235656 |
| Molecular Formula | C26H22O5S |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | (E)-3-[5-(1-benzothiophen-2-yl)-4-hydroxy-2-methoxyphenyl]-1-(3,5-dimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(OC)cc(C(=O)/C=C/c2cc(-c3cc4ccccc4s3)c(O)cc2OC)c1 |
| InChI | InChI=1S/C26H22O5S/c1-29-19-10-18(11-20(14-19)30-2)22(27)9-8-16-12-21(23(28)15-24(16)31-3)26-13-17-6-4-5-7-25(17)32-26/h4-15,28H,1-3H3/b9-8+ |
| InChIKey | FFACCRNTHYVHBV-CMDGGOBGSA-N |
| XLogP | 6.20 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|