C28H20N2O5S — CID 10278423
2-[4-(1-benzothiophen-2-yl)-5-methoxy-2-[(E)-3-oxo-3-quinazolin-8-ylprop-1-enyl]phenoxy]acetic acid (PubChem CID 10278423) has the molecular formula C28H20N2O5S and a molecular weight of 496.54 g/mol. Its IUPAC name is 2-[4-(1-benzothiophen-2-yl)-5-methoxy-2-[(E)-3-oxo-3-quinazolin-8-ylprop-1-enyl]phenoxy]acetic acid.
| Compound Name | 2-[4-(1-benzothiophen-2-yl)-5-methoxy-2-[(E)-3-oxo-3-quinazolin-8-ylprop-1-enyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 10278423 |
| Molecular Formula | C28H20N2O5S |
| Molecular Weight | 496.54 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | 2-[4-(1-benzothiophen-2-yl)-5-methoxy-2-[(E)-3-oxo-3-quinazolin-8-ylprop-1-enyl]phenoxy]acetic acid |
| SMILES | COc1cc(OCC(=O)O)c(/C=C/C(=O)c2cccc3cncnc23)cc1-c1cc2ccccc2s1 |
| InChI | InChI=1S/C28H20N2O5S/c1-34-24-13-23(35-15-27(32)33)17(11-21(24)26-12-18-5-2-3-8-25(18)36-26)9-10-22(31)20-7-4-6-19-14-29-16-30-28(19)20/h2-14,16H,15H2,1H3,(H,32,33)/b10-9+ |
| InChIKey | OCSAVLBBZNTBJR-MDZDMXLPSA-N |
| XLogP | 5.88 |
| TPSA | 98.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.54 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|