C31H30O8S — CID 142103409
2-[4-[(E)-5-[5-(1-benzothiophen-2-yl)-2,4-dimethoxyphenyl]pent-2-enoyl]-2,6-dimethoxyphenoxy]acetic acid (PubChem CID 142103409) has the molecular formula C31H30O8S and a molecular weight of 562.64 g/mol. Its IUPAC name is 2-[4-[(E)-5-[5-(1-benzothiophen-2-yl)-2,4-dimethoxyphenyl]pent-2-enoyl]-2,6-dimethoxyphenoxy]acetic acid.
| Compound Name | 2-[4-[(E)-5-[5-(1-benzothiophen-2-yl)-2,4-dimethoxyphenyl]pent-2-enoyl]-2,6-dimethoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 142103409 |
| Molecular Formula | C31H30O8S |
| Molecular Weight | 562.64 g/mol |
| Exact Mass | 562.17 |
| IUPAC Name | 2-[4-[(E)-5-[5-(1-benzothiophen-2-yl)-2,4-dimethoxyphenyl]pent-2-enoyl]-2,6-dimethoxyphenoxy]acetic acid |
| SMILES | COc1cc(OC)c(-c2cc3ccccc3s2)cc1CC/C=C/C(=O)c1cc(OC)c(OCC(=O)O)c(OC)c1 |
| InChI | InChI=1S/C31H30O8S/c1-35-24-17-25(36-2)22(29-16-20-10-6-8-12-28(20)40-29)13-19(24)9-5-7-11-23(32)21-14-26(37-3)31(27(15-21)38-4)39-18-30(33)34/h6-8,10-17H,5,9,18H2,1-4H3,(H,33,34)/b11-7+ |
| InChIKey | KFAYDGYPCYWWSR-YRNVUSSQSA-N |
| XLogP | 6.44 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.64 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|