C21H16BrN3O — CID 164623713
(E)-3-(3-bromophenyl)-N-(9H-pyrido[3,4-b]indol-1-ylmethyl)prop-2-enamide (PubChem CID 164623713) has the molecular formula C21H16BrN3O and a molecular weight of 406.28 g/mol. Its IUPAC name is (E)-3-(3-bromophenyl)-N-(9H-pyrido[3,4-b]indol-1-ylmethyl)prop-2-enamide.
| Compound Name | (E)-3-(3-bromophenyl)-N-(9H-pyrido[3,4-b]indol-1-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 164623713 |
| Molecular Formula | C21H16BrN3O |
| Molecular Weight | 406.28 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | (E)-3-(3-bromophenyl)-N-(9H-pyrido[3,4-b]indol-1-ylmethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cccc(Br)c1)NCc1nccc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C21H16BrN3O/c22-15-5-3-4-14(12-15)8-9-20(26)24-13-19-21-17(10-11-23-19)16-6-1-2-7-18(16)25-21/h1-12,25H,13H2,(H,24,26)/b9-8+ |
| InChIKey | QPDYOXCFOAKQEC-CMDGGOBGSA-N |
| XLogP | 4.81 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.28 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|