C25H25N3O2 — CID 6279501
N-cyclohexyl-1-(3-methoxyphenyl)-9H-pyrido[3,4-b]indole-3-carboxamide (PubChem CID 6279501) has the molecular formula C25H25N3O2 and a molecular weight of 399.49 g/mol. Its IUPAC name is N-cyclohexyl-1-(3-methoxyphenyl)-9H-pyrido[3,4-b]indole-3-carboxamide.
| Compound Name | N-cyclohexyl-1-(3-methoxyphenyl)-9H-pyrido[3,4-b]indole-3-carboxamide |
|---|---|
| PubChem CID | 6279501 |
| Molecular Formula | C25H25N3O2 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | N-cyclohexyl-1-(3-methoxyphenyl)-9H-pyrido[3,4-b]indole-3-carboxamide |
| SMILES | COc1cccc(-c2nc(C(=O)NC3CCCCC3)cc3c2[nH]c2ccccc23)c1 |
| InChI | InChI=1S/C25H25N3O2/c1-30-18-11-7-8-16(14-18)23-24-20(19-12-5-6-13-21(19)27-24)15-22(28-23)25(29)26-17-9-3-2-4-10-17/h5-8,11-15,17,27H,2-4,9-10H2,1H3,(H,26,29) |
| InChIKey | YAGPZBHAHYLOES-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |