About N-cyclohexyl-1-(3-methoxyphenyl)-9H-pyrido[3,4-b]indole-3-carboxamide
N-cyclohexyl-1-(3-methoxyphenyl)-9H-pyrido[3,4-b]indole-3-carboxamide (PubChem CID 6279501) has the molecular formula C25H25N3O2
and a molecular weight of 399.49 g/mol. Its IUPAC name is N-cyclohexyl-1-(3-methoxyphenyl)-9H-pyrido[3,4-b]indole-3-carboxamide.
Molecular Properties
| Compound Name | N-cyclohexyl-1-(3-methoxyphenyl)-9H-pyrido[3,4-b]indole-3-carboxamide |
| PubChem CID | 6279501 |
| Molecular Formula | C25H25N3O2 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | N-cyclohexyl-1-(3-methoxyphenyl)-9H-pyrido[3,4-b]indole-3-carboxamide |
| SMILES | COc1cccc(-c2nc(C(=O)NC3CCCCC3)cc3c2[nH]c2ccccc23)c1 |
| InChI | InChI=1S/C25H25N3O2/c1-30-18-11-7-8-16(14-18)23-24-20(19-12-5-6-13-21(19)27-24)15-22(28-23)25(29)26-17-9-3-2-4-10-17/h5-8,11-15,17,27H,2-4,9-10H2,1H3,(H,26,29) |
| InChIKey | YAGPZBHAHYLOES-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cyclohexyl-1-(3-methoxyphenyl)-9H-pyrido[3,4-b]indole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-1-(3-methoxyphenyl)-9H-pyrido[3,4-b]indole-3-carboxamide?
The IUPAC name of N-cyclohexyl-1-(3-methoxyphenyl)-9H-pyrido[3,4-b]indole-3-carboxamide (CID 6279501) is N-cyclohexyl-1-(3-methoxyphenyl)-9H-pyrido[3,4-b]indole-3-carboxamide.
What is the SMILES notation for N-cyclohexyl-1-(3-methoxyphenyl)-9H-pyrido[3,4-b]indole-3-carboxamide?
The canonical SMILES for N-cyclohexyl-1-(3-methoxyphenyl)-9H-pyrido[3,4-b]indole-3-carboxamide is COc1cccc(-c2nc(C(=O)NC3CCCCC3)cc3c2[nH]c2ccccc23)c1.
What is the InChIKey of N-cyclohexyl-1-(3-methoxyphenyl)-9H-pyrido[3,4-b]indole-3-carboxamide?
The InChIKey is YAGPZBHAHYLOES-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H25N3O2/c1-30-18-11-7-8-16(14-18)23-24-20(19-12-5-6-13-21(19)27-24)15-22(28-23)25(29)26-17-9-3-2-4-10-17/h5-8,11-15,17,27H,2-4,9-10H2,1H3,(H,26,29).
What are the key properties of N-cyclohexyl-1-(3-methoxyphenyl)-9H-pyrido[3,4-b]indole-3-carboxamide?
N-cyclohexyl-1-(3-methoxyphenyl)-9H-pyrido[3,4-b]indole-3-carboxamide has a molecular weight of 399.49 g/mol, XLogP of 5.45, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-1-(3-methoxyphenyl)-9H-pyrido[3,4-b]indole-3-carboxamide is sourced from PubChem (CID 6279501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).