C25H26N2O4 — CID 141484492
butyl 1-(3,4-dimethoxyphenyl)-9-methylpyrido[3,4-b]indole-3-carboxylate (PubChem CID 141484492) has the molecular formula C25H26N2O4 and a molecular weight of 418.49 g/mol. Its IUPAC name is butyl 1-(3,4-dimethoxyphenyl)-9-methylpyrido[3,4-b]indole-3-carboxylate.
| Compound Name | butyl 1-(3,4-dimethoxyphenyl)-9-methylpyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 141484492 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | butyl 1-(3,4-dimethoxyphenyl)-9-methylpyrido[3,4-b]indole-3-carboxylate |
| SMILES | CCCCOC(=O)c1cc2c3ccccc3n(C)c2c(-c2ccc(OC)c(OC)c2)n1 |
| InChI | InChI=1S/C25H26N2O4/c1-5-6-13-31-25(28)19-15-18-17-9-7-8-10-20(17)27(2)24(18)23(26-19)16-11-12-21(29-3)22(14-16)30-4/h7-12,14-15H,5-6,13H2,1-4H3 |
| InChIKey | VLOFCSNNKGUTEX-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|