C12H10N2 — CID 46781679
1-(trideuteriomethyl)-9H-pyrido[3,4-b]indole (PubChem CID 46781679) has the molecular formula C12H10N2 and a molecular weight of 185.24 g/mol. Its IUPAC name is 1-(trideuteriomethyl)-9H-pyrido[3,4-b]indole.
| Compound Name | 1-(trideuteriomethyl)-9H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 46781679 |
| Molecular Formula | C12H10N2 |
| Molecular Weight | 185.24 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 1-(trideuteriomethyl)-9H-pyrido[3,4-b]indole |
| SMILES | [2H]C([2H])([2H])c1nccc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C12H10N2/c1-8-12-10(6-7-13-8)9-4-2-3-5-11(9)14-12/h2-7,14H,1H3/i1D3 |
| InChIKey | PSFDQSOCUJVVGF-FIBGUPNXSA-N |
| XLogP | 3.02 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.24 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |