C12H9N3O — CID 174580946
N-(9H-pyrido[3,4-b]indol-1-yl)formamide (PubChem CID 174580946) has the molecular formula C12H9N3O and a molecular weight of 211.22 g/mol. Its IUPAC name is N-(9H-pyrido[3,4-b]indol-1-yl)formamide.
| Compound Name | N-(9H-pyrido[3,4-b]indol-1-yl)formamide |
|---|---|
| PubChem CID | 174580946 |
| Molecular Formula | C12H9N3O |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | N-(9H-pyrido[3,4-b]indol-1-yl)formamide |
| SMILES | O=CNc1nccc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C12H9N3O/c16-7-14-12-11-9(5-6-13-12)8-3-1-2-4-10(8)15-11/h1-7,15H,(H,13,14,16) |
| InChIKey | WPDXPKZSGOCHOY-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|