About N-(9H-pyrido[3,4-b]indol-1-yl)formamide
N-(9H-pyrido[3,4-b]indol-1-yl)formamide (PubChem CID 174580946) has the molecular formula C12H9N3O
and a molecular weight of 211.22 g/mol. Its IUPAC name is N-(9H-pyrido[3,4-b]indol-1-yl)formamide.
Molecular Properties
| Compound Name | N-(9H-pyrido[3,4-b]indol-1-yl)formamide |
| PubChem CID | 174580946 |
| Molecular Formula | C12H9N3O |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | N-(9H-pyrido[3,4-b]indol-1-yl)formamide |
| SMILES | O=CNc1nccc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C12H9N3O/c16-7-14-12-11-9(5-6-13-12)8-3-1-2-4-10(8)15-11/h1-7,15H,(H,13,14,16) |
| InChIKey | WPDXPKZSGOCHOY-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-(9H-pyrido[3,4-b]indol-1-yl)formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(9H-pyrido[3,4-b]indol-1-yl)formamide?
The IUPAC name of N-(9H-pyrido[3,4-b]indol-1-yl)formamide (CID 174580946) is N-(9H-pyrido[3,4-b]indol-1-yl)formamide.
What is the SMILES notation for N-(9H-pyrido[3,4-b]indol-1-yl)formamide?
The canonical SMILES for N-(9H-pyrido[3,4-b]indol-1-yl)formamide is O=CNc1nccc2c1[nH]c1ccccc12.
What is the InChIKey of N-(9H-pyrido[3,4-b]indol-1-yl)formamide?
The InChIKey is WPDXPKZSGOCHOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N3O/c16-7-14-12-11-9(5-6-13-12)8-3-1-2-4-10(8)15-11/h1-7,15H,(H,13,14,16).
What are the key properties of N-(9H-pyrido[3,4-b]indol-1-yl)formamide?
N-(9H-pyrido[3,4-b]indol-1-yl)formamide has a molecular weight of 211.22 g/mol, XLogP of 2.28, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(9H-pyrido[3,4-b]indol-1-yl)formamide is sourced from PubChem (CID 174580946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).