C24H22N4O4 — CID 175372118
benzyl (2S)-5-amino-3-formyl-5-oxo-2-(9H-pyrido[3,4-b]indol-1-ylamino)pentanoate (PubChem CID 175372118) has the molecular formula C24H22N4O4 and a molecular weight of 430.46 g/mol. Its IUPAC name is benzyl (2S)-5-amino-3-formyl-5-oxo-2-(9H-pyrido[3,4-b]indol-1-ylamino)pentanoate.
| Compound Name | benzyl (2S)-5-amino-3-formyl-5-oxo-2-(9H-pyrido[3,4-b]indol-1-ylamino)pentanoate |
|---|---|
| PubChem CID | 175372118 |
| Molecular Formula | C24H22N4O4 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | benzyl (2S)-5-amino-3-formyl-5-oxo-2-(9H-pyrido[3,4-b]indol-1-ylamino)pentanoate |
| SMILES | NC(=O)CC(C=O)[C@H](Nc1nccc2c1[nH]c1ccccc12)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H22N4O4/c25-20(30)12-16(13-29)21(24(31)32-14-15-6-2-1-3-7-15)28-23-22-18(10-11-26-23)17-8-4-5-9-19(17)27-22/h1-11,13,16,21,27H,12,14H2,(H2,25,30)(H,26,28)/t16?,21-/m0/s1 |
| InChIKey | FVWUHKQRLVDKRS-MRNPHLECSA-N |
| XLogP | 2.93 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|