C24H24N4O4 — CID 175372119
benzyl 2,5-diamino-3-formyl-5-oxopentanoate;9H-pyrido[3,4-b]indole (PubChem CID 175372119) has the molecular formula C24H24N4O4 and a molecular weight of 432.48 g/mol. Its IUPAC name is benzyl 2,5-diamino-3-formyl-5-oxopentanoate;9H-pyrido[3,4-b]indole.
| Compound Name | benzyl 2,5-diamino-3-formyl-5-oxopentanoate;9H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 175372119 |
| Molecular Formula | C24H24N4O4 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | benzyl 2,5-diamino-3-formyl-5-oxopentanoate;9H-pyrido[3,4-b]indole |
| SMILES | NC(=O)CC(C=O)C(N)C(=O)OCc1ccccc1.c1ccc2c(c1)[nH]c1cnccc12 |
| InChI | InChI=1S/C13H16N2O4.C11H8N2/c14-11(17)6-10(7-16)12(15)13(18)19-8-9-4-2-1-3-5-9;1-2-4-10-8(3-1)9-5-6-12-7-11(9)13-10/h1-5,7,10,12H,6,8,15H2,(H2,14,17);1-7,13H |
| InChIKey | JGKASQCIZYQSDG-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 141.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|