C22H21N3O3 — CID 175356072
benzyl 2-amino-4-oxobutanoate;9H-pyrido[3,4-b]indole (PubChem CID 175356072) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is benzyl 2-amino-4-oxobutanoate;9H-pyrido[3,4-b]indole.
| Compound Name | benzyl 2-amino-4-oxobutanoate;9H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 175356072 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | benzyl 2-amino-4-oxobutanoate;9H-pyrido[3,4-b]indole |
| SMILES | NC(CC=O)C(=O)OCc1ccccc1.c1ccc2c(c1)[nH]c1cnccc12 |
| InChI | InChI=1S/C11H8N2.C11H13NO3/c1-2-4-10-8(3-1)9-5-6-12-7-11(9)13-10;12-10(6-7-13)11(14)15-8-9-4-2-1-3-5-9/h1-7,13H;1-5,7,10H,6,8,12H2 |
| InChIKey | MSAVREKQGJPJSI-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|