C24H25N3O3 — CID 175386817
benzyl 2-amino-3,3-dimethyl-4-oxobutanoate;9H-pyrido[3,4-b]indole (PubChem CID 175386817) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is benzyl 2-amino-3,3-dimethyl-4-oxobutanoate;9H-pyrido[3,4-b]indole.
| Compound Name | benzyl 2-amino-3,3-dimethyl-4-oxobutanoate;9H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 175386817 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | benzyl 2-amino-3,3-dimethyl-4-oxobutanoate;9H-pyrido[3,4-b]indole |
| SMILES | CC(C)(C=O)C(N)C(=O)OCc1ccccc1.c1ccc2c(c1)[nH]c1cnccc12 |
| InChI | InChI=1S/C13H17NO3.C11H8N2/c1-13(2,9-15)11(14)12(16)17-8-10-6-4-3-5-7-10;1-2-4-10-8(3-1)9-5-6-12-7-11(9)13-10/h3-7,9,11H,8,14H2,1-2H3;1-7,13H |
| InChIKey | GGBBKXHDKNGSGS-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|