C32H39N3O5 — CID 174738101
benzyl 2-amino-3-formyl-4-methylpentanoate;1-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]-9H-pyrido[3,4-b]indole (PubChem CID 174738101) has the molecular formula C32H39N3O5 and a molecular weight of 545.68 g/mol. Its IUPAC name is benzyl 2-amino-3-formyl-4-methylpentanoate;1-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]-9H-pyrido[3,4-b]indole.
| Compound Name | benzyl 2-amino-3-formyl-4-methylpentanoate;1-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]-9H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 174738101 |
| Molecular Formula | C32H39N3O5 |
| Molecular Weight | 545.68 g/mol |
| Exact Mass | 545.29 |
| IUPAC Name | benzyl 2-amino-3-formyl-4-methylpentanoate;1-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]-9H-pyrido[3,4-b]indole |
| SMILES | CC(C)C(C=O)C(N)C(=O)OCc1ccccc1.CC1(C)COC(Cc2nccc3c2[nH]c2ccccc23)OC1 |
| InChI | InChI=1S/C18H20N2O2.C14H19NO3/c1-18(2)10-21-16(22-11-18)9-15-17-13(7-8-19-15)12-5-3-4-6-14(12)20-17;1-10(2)12(8-16)13(15)14(17)18-9-11-6-4-3-5-7-11/h3-8,16,20H,9-11H2,1-2H3;3-8,10,12-13H,9,15H2,1-2H3 |
| InChIKey | RHWFKALUSJQSDR-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 116.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.68 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|