C19H22N2O4 — CID 101164488
(2R,3S,4R,6S)-2-methyl-6-[2-(9H-pyrido[3,4-b]indol-1-yl)ethoxy]oxane-3,4-diol (PubChem CID 101164488) has the molecular formula C19H22N2O4 and a molecular weight of 342.39 g/mol. Its IUPAC name is (2R,3S,4R,6S)-2-methyl-6-[2-(9H-pyrido[3,4-b]indol-1-yl)ethoxy]oxane-3,4-diol.
| Compound Name | (2R,3S,4R,6S)-2-methyl-6-[2-(9H-pyrido[3,4-b]indol-1-yl)ethoxy]oxane-3,4-diol |
|---|---|
| PubChem CID | 101164488 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | (2R,3S,4R,6S)-2-methyl-6-[2-(9H-pyrido[3,4-b]indol-1-yl)ethoxy]oxane-3,4-diol |
| SMILES | C[C@H]1O[C@H](OCCc2nccc3c2[nH]c2ccccc23)C[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H22N2O4/c1-11-19(23)16(22)10-17(25-11)24-9-7-15-18-13(6-8-20-15)12-4-2-3-5-14(12)21-18/h2-6,8,11,16-17,19,21-23H,7,9-10H2,1H3/t11-,16-,17+,19-/m1/s1 |
| InChIKey | SITQFDSSEPKUNX-YMPHWICMSA-N |
| XLogP | 2.13 |
| TPSA | 87.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |