C20H18N2O2 — CID 5358763
1-(4-methoxyphenyl)-2-(9H-pyrido[3,4-b]indol-1-yl)ethanol (PubChem CID 5358763) has the molecular formula C20H18N2O2 and a molecular weight of 318.38 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-2-(9H-pyrido[3,4-b]indol-1-yl)ethanol.
| Compound Name | 1-(4-methoxyphenyl)-2-(9H-pyrido[3,4-b]indol-1-yl)ethanol |
|---|---|
| PubChem CID | 5358763 |
| Molecular Formula | C20H18N2O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 1-(4-methoxyphenyl)-2-(9H-pyrido[3,4-b]indol-1-yl)ethanol |
| SMILES | COc1ccc(C(O)Cc2nccc3c2[nH]c2ccccc23)cc1 |
| InChI | InChI=1S/C20H18N2O2/c1-24-14-8-6-13(7-9-14)19(23)12-18-20-16(10-11-21-18)15-4-2-3-5-17(15)22-20/h2-11,19,22-23H,12H2,1H3 |
| InChIKey | ZNHDLUHYWBYUJI-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 58.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |