C18H9F5N2 — CID 175324734
1-[(2,3,4,5,6-pentafluorophenyl)methyl]-9H-pyrido[3,4-b]indole (PubChem CID 175324734) has the molecular formula C18H9F5N2 and a molecular weight of 348.27 g/mol. Its IUPAC name is 1-[(2,3,4,5,6-pentafluorophenyl)methyl]-9H-pyrido[3,4-b]indole.
| Compound Name | 1-[(2,3,4,5,6-pentafluorophenyl)methyl]-9H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 175324734 |
| Molecular Formula | C18H9F5N2 |
| Molecular Weight | 348.27 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 1-[(2,3,4,5,6-pentafluorophenyl)methyl]-9H-pyrido[3,4-b]indole |
| SMILES | Fc1c(F)c(F)c(Cc2nccc3c2[nH]c2ccccc23)c(F)c1F |
| InChI | InChI=1S/C18H9F5N2/c19-13-10(14(20)16(22)17(23)15(13)21)7-12-18-9(5-6-24-12)8-3-1-2-4-11(8)25-18/h1-6,25H,7H2 |
| InChIKey | OLNXPZOEYHUNMZ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.27 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|