C27H31N3O4 — CID 174737949
benzyl 2-amino-3-formyl-4-methylpentanoate;9-methoxy-1-methylpyrido[3,4-b]indole (PubChem CID 174737949) has the molecular formula C27H31N3O4 and a molecular weight of 461.56 g/mol. Its IUPAC name is benzyl 2-amino-3-formyl-4-methylpentanoate;9-methoxy-1-methylpyrido[3,4-b]indole.
| Compound Name | benzyl 2-amino-3-formyl-4-methylpentanoate;9-methoxy-1-methylpyrido[3,4-b]indole |
|---|---|
| PubChem CID | 174737949 |
| Molecular Formula | C27H31N3O4 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | benzyl 2-amino-3-formyl-4-methylpentanoate;9-methoxy-1-methylpyrido[3,4-b]indole |
| SMILES | CC(C)C(C=O)C(N)C(=O)OCc1ccccc1.COn1c2ccccc2c2ccnc(C)c21 |
| InChI | InChI=1S/C14H19NO3.C13H12N2O/c1-10(2)12(8-16)13(15)14(17)18-9-11-6-4-3-5-7-11;1-9-13-11(7-8-14-9)10-5-3-4-6-12(10)15(13)16-2/h3-8,10,12-13H,9,15H2,1-2H3;3-8H,1-2H3 |
| InChIKey | HCTZSGKRYUCDEJ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|