About 9-methoxy-N,5-dimethyl-6H-pyrido[4,3-b]carbazol-1-amine
9-methoxy-N,5-dimethyl-6H-pyrido[4,3-b]carbazol-1-amine (PubChem CID 70887380) has the molecular formula C18H17N3O
and a molecular weight of 291.35 g/mol. Its IUPAC name is 9-methoxy-N,5-dimethyl-6H-pyrido[4,3-b]carbazol-1-amine.
Molecular Properties
| Compound Name | 9-methoxy-N,5-dimethyl-6H-pyrido[4,3-b]carbazol-1-amine |
| PubChem CID | 70887380 |
| Molecular Formula | C18H17N3O |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 9-methoxy-N,5-dimethyl-6H-pyrido[4,3-b]carbazol-1-amine |
| SMILES | CNc1nccc2c(C)c3[nH]c4ccc(OC)cc4c3cc12 |
| InChI | InChI=1S/C18H17N3O/c1-10-12-6-7-20-18(19-2)15(12)9-14-13-8-11(22-3)4-5-16(13)21-17(10)14/h4-9,21H,1-3H3,(H,19,20) |
| InChIKey | AGQBAGCWJVMBHY-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-methoxy-N,5-dimethyl-6H-pyrido[4,3-b]carbazol-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methoxy-N,5-dimethyl-6H-pyrido[4,3-b]carbazol-1-amine?
The IUPAC name of 9-methoxy-N,5-dimethyl-6H-pyrido[4,3-b]carbazol-1-amine (CID 70887380) is 9-methoxy-N,5-dimethyl-6H-pyrido[4,3-b]carbazol-1-amine.
What is the SMILES notation for 9-methoxy-N,5-dimethyl-6H-pyrido[4,3-b]carbazol-1-amine?
The canonical SMILES for 9-methoxy-N,5-dimethyl-6H-pyrido[4,3-b]carbazol-1-amine is CNc1nccc2c(C)c3[nH]c4ccc(OC)cc4c3cc12.
What is the InChIKey of 9-methoxy-N,5-dimethyl-6H-pyrido[4,3-b]carbazol-1-amine?
The InChIKey is AGQBAGCWJVMBHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3O/c1-10-12-6-7-20-18(19-2)15(12)9-14-13-8-11(22-3)4-5-16(13)21-17(10)14/h4-9,21H,1-3H3,(H,19,20).
What are the key properties of 9-methoxy-N,5-dimethyl-6H-pyrido[4,3-b]carbazol-1-amine?
9-methoxy-N,5-dimethyl-6H-pyrido[4,3-b]carbazol-1-amine has a molecular weight of 291.35 g/mol, XLogP of 4.23, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methoxy-N,5-dimethyl-6H-pyrido[4,3-b]carbazol-1-amine is sourced from PubChem (CID 70887380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).