C9H11NO5 — CID 143267178
ethane;4-oxo-1H-pyridine-2,6-dicarboxylic acid (PubChem CID 143267178) has the molecular formula C9H11NO5 and a molecular weight of 213.19 g/mol. Its IUPAC name is ethane;4-oxo-1H-pyridine-2,6-dicarboxylic acid.
| Compound Name | ethane;4-oxo-1H-pyridine-2,6-dicarboxylic acid |
|---|---|
| PubChem CID | 143267178 |
| Molecular Formula | C9H11NO5 |
| Molecular Weight | 213.19 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | ethane;4-oxo-1H-pyridine-2,6-dicarboxylic acid |
| SMILES | CC.O=C(O)c1cc(=O)cc(C(=O)O)[nH]1 |
| InChI | InChI=1S/C7H5NO5.C2H6/c9-3-1-4(6(10)11)8-5(2-3)7(12)13;1-2/h1-2H,(H,8,9)(H,10,11)(H,12,13);1-2H3 |
| InChIKey | QJCZGBIUADJWKA-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.19 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |