About ethane;(5Z)-5-ethylidene-4-methylidene-1H-pyrrole-2-carboxylic acid
ethane;(5Z)-5-ethylidene-4-methylidene-1H-pyrrole-2-carboxylic acid (PubChem CID 166140081) has the molecular formula C10H15NO2
and a molecular weight of 181.23 g/mol. Its IUPAC name is ethane;(5Z)-5-ethylidene-4-methylidene-1H-pyrrole-2-carboxylic acid.
Molecular Properties
| Compound Name | ethane;(5Z)-5-ethylidene-4-methylidene-1H-pyrrole-2-carboxylic acid |
| PubChem CID | 166140081 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | ethane;(5Z)-5-ethylidene-4-methylidene-1H-pyrrole-2-carboxylic acid |
| SMILES | C=c1cc(C(=O)O)[nH]/c1=C\C.CC |
| InChI | InChI=1S/C8H9NO2.C2H6/c1-3-6-5(2)4-7(9-6)8(10)11;1-2/h3-4,9H,2H2,1H3,(H,10,11);1-2H3/b6-3-; |
| InChIKey | MUGKMGMCPSLTSN-AQPBACSKSA-N |
| XLogP | 0.95 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;(5Z)-5-ethylidene-4-methylidene-1H-pyrrole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(5Z)-5-ethylidene-4-methylidene-1H-pyrrole-2-carboxylic acid?
The IUPAC name of ethane;(5Z)-5-ethylidene-4-methylidene-1H-pyrrole-2-carboxylic acid (CID 166140081) is ethane;(5Z)-5-ethylidene-4-methylidene-1H-pyrrole-2-carboxylic acid.
What is the SMILES notation for ethane;(5Z)-5-ethylidene-4-methylidene-1H-pyrrole-2-carboxylic acid?
The canonical SMILES for ethane;(5Z)-5-ethylidene-4-methylidene-1H-pyrrole-2-carboxylic acid is C=c1cc(C(=O)O)[nH]/c1=C\C.CC.
What is the InChIKey of ethane;(5Z)-5-ethylidene-4-methylidene-1H-pyrrole-2-carboxylic acid?
The InChIKey is MUGKMGMCPSLTSN-AQPBACSKSA-N. The full InChI is InChI=1S/C8H9NO2.C2H6/c1-3-6-5(2)4-7(9-6)8(10)11;1-2/h3-4,9H,2H2,1H3,(H,10,11);1-2H3/b6-3-;.
What are the key properties of ethane;(5Z)-5-ethylidene-4-methylidene-1H-pyrrole-2-carboxylic acid?
ethane;(5Z)-5-ethylidene-4-methylidene-1H-pyrrole-2-carboxylic acid has a molecular weight of 181.23 g/mol, XLogP of 0.95, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(5Z)-5-ethylidene-4-methylidene-1H-pyrrole-2-carboxylic acid is sourced from PubChem (CID 166140081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).