About ethane;methyl (4Z,5E)-5-ethylidene-4-prop-2-enylidene-1H-pyrrole-2-carboxylate
ethane;methyl (4Z,5E)-5-ethylidene-4-prop-2-enylidene-1H-pyrrole-2-carboxylate (PubChem CID 145311762) has the molecular formula C13H19NO2
and a molecular weight of 221.30 g/mol. Its IUPAC name is ethane;methyl (4Z,5E)-5-ethylidene-4-prop-2-enylidene-1H-pyrrole-2-carboxylate.
Molecular Properties
| Compound Name | ethane;methyl (4Z,5E)-5-ethylidene-4-prop-2-enylidene-1H-pyrrole-2-carboxylate |
| PubChem CID | 145311762 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | ethane;methyl (4Z,5E)-5-ethylidene-4-prop-2-enylidene-1H-pyrrole-2-carboxylate |
| SMILES | C=C/C=c1/cc(C(=O)OC)[nH]/c1=C/C.CC |
| InChI | InChI=1S/C11H13NO2.C2H6/c1-4-6-8-7-10(11(13)14-3)12-9(8)5-2;1-2/h4-7,12H,1H2,2-3H3;1-2H3/b8-6-,9-5+; |
| InChIKey | UFERDFCMPJOBJS-MWGMOTBOSA-N |
| XLogP | 1.59 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;methyl (4Z,5E)-5-ethylidene-4-prop-2-enylidene-1H-pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl (4Z,5E)-5-ethylidene-4-prop-2-enylidene-1H-pyrrole-2-carboxylate?
The IUPAC name of ethane;methyl (4Z,5E)-5-ethylidene-4-prop-2-enylidene-1H-pyrrole-2-carboxylate (CID 145311762) is ethane;methyl (4Z,5E)-5-ethylidene-4-prop-2-enylidene-1H-pyrrole-2-carboxylate.
What is the SMILES notation for ethane;methyl (4Z,5E)-5-ethylidene-4-prop-2-enylidene-1H-pyrrole-2-carboxylate?
The canonical SMILES for ethane;methyl (4Z,5E)-5-ethylidene-4-prop-2-enylidene-1H-pyrrole-2-carboxylate is C=C/C=c1/cc(C(=O)OC)[nH]/c1=C/C.CC.
What is the InChIKey of ethane;methyl (4Z,5E)-5-ethylidene-4-prop-2-enylidene-1H-pyrrole-2-carboxylate?
The InChIKey is UFERDFCMPJOBJS-MWGMOTBOSA-N. The full InChI is InChI=1S/C11H13NO2.C2H6/c1-4-6-8-7-10(11(13)14-3)12-9(8)5-2;1-2/h4-7,12H,1H2,2-3H3;1-2H3/b8-6-,9-5+;.
What are the key properties of ethane;methyl (4Z,5E)-5-ethylidene-4-prop-2-enylidene-1H-pyrrole-2-carboxylate?
ethane;methyl (4Z,5E)-5-ethylidene-4-prop-2-enylidene-1H-pyrrole-2-carboxylate has a molecular weight of 221.30 g/mol, XLogP of 1.59, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl (4Z,5E)-5-ethylidene-4-prop-2-enylidene-1H-pyrrole-2-carboxylate is sourced from PubChem (CID 145311762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).