C8H10N2O2 — CID 138573207
methyl (4E)-4-ethylidene-5-methylidene-1H-imidazole-2-carboxylate (PubChem CID 138573207) has the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. Its IUPAC name is methyl (4E)-4-ethylidene-5-methylidene-1H-imidazole-2-carboxylate.
| Compound Name | methyl (4E)-4-ethylidene-5-methylidene-1H-imidazole-2-carboxylate |
|---|---|
| PubChem CID | 138573207 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | methyl (4E)-4-ethylidene-5-methylidene-1H-imidazole-2-carboxylate |
| SMILES | C=c1[nH]c(C(=O)OC)n/c1=C/C |
| InChI | InChI=1S/C8H10N2O2/c1-4-6-5(2)9-7(10-6)8(11)12-3/h4H,2H2,1,3H3,(H,9,10)/b6-4+ |
| InChIKey | VMRIFEGHIFHGPO-GQCTYLIASA-N |
| XLogP | -0.59 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |