C13H12N2O4 — CID 79436249
methyl 4-hydroxy-5-(4-methylphenyl)-6-oxo-1H-pyrimidine-2-carboxylate (PubChem CID 79436249) has the molecular formula C13H12N2O4 and a molecular weight of 260.25 g/mol. Its IUPAC name is methyl 4-hydroxy-5-(4-methylphenyl)-6-oxo-1H-pyrimidine-2-carboxylate.
| Compound Name | methyl 4-hydroxy-5-(4-methylphenyl)-6-oxo-1H-pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 79436249 |
| Molecular Formula | C13H12N2O4 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | methyl 4-hydroxy-5-(4-methylphenyl)-6-oxo-1H-pyrimidine-2-carboxylate |
| SMILES | COC(=O)c1nc(O)c(-c2ccc(C)cc2)c(=O)[nH]1 |
| InChI | InChI=1S/C13H12N2O4/c1-7-3-5-8(6-4-7)9-11(16)14-10(13(18)19-2)15-12(9)17/h3-6H,1-2H3,(H2,14,15,16,17) |
| InChIKey | ODPXUAHQNBNUKN-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 92.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |