C12H10ClN3O3 — CID 135499579
methyl 2-amino-5-(4-chlorophenyl)-6-oxo-1H-pyrimidine-4-carboxylate (PubChem CID 135499579) has the molecular formula C12H10ClN3O3 and a molecular weight of 279.68 g/mol. Its IUPAC name is methyl 2-amino-5-(4-chlorophenyl)-6-oxo-1H-pyrimidine-4-carboxylate.
| Compound Name | methyl 2-amino-5-(4-chlorophenyl)-6-oxo-1H-pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 135499579 |
| Molecular Formula | C12H10ClN3O3 |
| Molecular Weight | 279.68 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | methyl 2-amino-5-(4-chlorophenyl)-6-oxo-1H-pyrimidine-4-carboxylate |
| SMILES | COC(=O)c1nc(N)[nH]c(=O)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H10ClN3O3/c1-19-11(18)9-8(10(17)16-12(14)15-9)6-2-4-7(13)5-3-6/h2-5H,1H3,(H3,14,15,16,17) |
| InChIKey | ZHUJLELWTXQIOW-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.68 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |