C18H16N2O4 — CID 165345881
4-hydroxy-2,5-bis(4-methoxyphenyl)-1H-pyrimidin-6-one (PubChem CID 165345881) has the molecular formula C18H16N2O4 and a molecular weight of 324.34 g/mol. Its IUPAC name is 4-hydroxy-2,5-bis(4-methoxyphenyl)-1H-pyrimidin-6-one.
| Compound Name | 4-hydroxy-2,5-bis(4-methoxyphenyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 165345881 |
| Molecular Formula | C18H16N2O4 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 4-hydroxy-2,5-bis(4-methoxyphenyl)-1H-pyrimidin-6-one |
| SMILES | COc1ccc(-c2nc(O)c(-c3ccc(OC)cc3)c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C18H16N2O4/c1-23-13-7-3-11(4-8-13)15-17(21)19-16(20-18(15)22)12-5-9-14(24-2)10-6-12/h3-10H,1-2H3,(H2,19,20,21,22) |
| InChIKey | BTFJMSAXCWAZCC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 84.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |