C8H10N2O3S — CID 106477619
methyl 6-(methoxymethyl)-4-sulfanylidene-1H-pyrimidine-2-carboxylate (PubChem CID 106477619) has the molecular formula C8H10N2O3S and a molecular weight of 214.25 g/mol. Its IUPAC name is methyl 6-(methoxymethyl)-4-sulfanylidene-1H-pyrimidine-2-carboxylate.
| Compound Name | methyl 6-(methoxymethyl)-4-sulfanylidene-1H-pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 106477619 |
| Molecular Formula | C8H10N2O3S |
| Molecular Weight | 214.25 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | methyl 6-(methoxymethyl)-4-sulfanylidene-1H-pyrimidine-2-carboxylate |
| SMILES | COCc1cc(=S)nc(C(=O)OC)[nH]1 |
| InChI | InChI=1S/C8H10N2O3S/c1-12-4-5-3-6(14)10-7(9-5)8(11)13-2/h3H,4H2,1-2H3,(H,9,10,14) |
| InChIKey | XPMDIXFQLJZMMG-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.25 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|