C9H14N2O3S2 — CID 106477678
6-(methoxymethyl)-2-(1-methylsulfonylethyl)-1H-pyrimidine-4-thione (PubChem CID 106477678) has the molecular formula C9H14N2O3S2 and a molecular weight of 262.36 g/mol. Its IUPAC name is 6-(methoxymethyl)-2-(1-methylsulfonylethyl)-1H-pyrimidine-4-thione.
| Compound Name | 6-(methoxymethyl)-2-(1-methylsulfonylethyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106477678 |
| Molecular Formula | C9H14N2O3S2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | 6-(methoxymethyl)-2-(1-methylsulfonylethyl)-1H-pyrimidine-4-thione |
| SMILES | COCc1cc(=S)nc(C(C)S(C)(=O)=O)[nH]1 |
| InChI | InChI=1S/C9H14N2O3S2/c1-6(16(3,12)13)9-10-7(5-14-2)4-8(15)11-9/h4,6H,5H2,1-3H3,(H,10,11,15) |
| InChIKey | KTWMMRLMESEAIX-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|