C8H12N2O3S2 — CID 106477661
6-(methoxymethyl)-2-(methylsulfonylmethyl)-1H-pyrimidine-4-thione (PubChem CID 106477661) has the molecular formula C8H12N2O3S2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 6-(methoxymethyl)-2-(methylsulfonylmethyl)-1H-pyrimidine-4-thione.
| Compound Name | 6-(methoxymethyl)-2-(methylsulfonylmethyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106477661 |
| Molecular Formula | C8H12N2O3S2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.03 |
| IUPAC Name | 6-(methoxymethyl)-2-(methylsulfonylmethyl)-1H-pyrimidine-4-thione |
| SMILES | COCc1cc(=S)nc(CS(C)(=O)=O)[nH]1 |
| InChI | InChI=1S/C8H12N2O3S2/c1-13-4-6-3-8(14)10-7(9-6)5-15(2,11)12/h3H,4-5H2,1-2H3,(H,9,10,14) |
| InChIKey | FABDGRKBHZKKEK-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|