C7H6N2O2Se — CID 44543981
methyl 4H-pyrrolo[2,3-d][1,3]selenazole-5-carboxylate (PubChem CID 44543981) has the molecular formula C7H6N2O2Se and a molecular weight of 229.10 g/mol. Its IUPAC name is methyl 4H-pyrrolo[2,3-d][1,3]selenazole-5-carboxylate.
| Compound Name | methyl 4H-pyrrolo[2,3-d][1,3]selenazole-5-carboxylate |
|---|---|
| PubChem CID | 44543981 |
| Molecular Formula | C7H6N2O2Se |
| Molecular Weight | 229.10 g/mol |
| Exact Mass | 229.96 |
| IUPAC Name | methyl 4H-pyrrolo[2,3-d][1,3]selenazole-5-carboxylate |
| SMILES | COC(=O)c1cc2[se]cnc2[nH]1 |
| InChI | InChI=1S/C7H6N2O2Se/c1-11-7(10)4-2-5-6(9-4)8-3-12-5/h2-3,9H,1H3 |
| InChIKey | IEKYJAGLZBIYGC-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.10 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|