methyl 4-methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxylate

C10H10N2O2 — CID 71721167

IUPACmethyl 4-methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxylate
SMILESCOC(=O)c1cc2c(C)ccnc2[nH]1
InChIInChI=1S/C10H10N2O2/c1-6-3-4-11-9-7(6)5-8(12-9)10(13)14-2/h3-5H,1-2H3,(H,11,12)
InChIKeyMORUICYTOYJQIQ-UHFFFAOYSA-N
MW190.20 g/mol
LogP1.66
Rot. Bonds1

About methyl 4-methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxylate

methyl 4-methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxylate (PubChem CID 71721167) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is methyl 4-methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxylate.

Molecular Properties

Compound Namemethyl 4-methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxylate
PubChem CID71721167
Molecular FormulaC10H10N2O2
Molecular Weight190.20 g/mol
Exact Mass190.07
IUPAC Namemethyl 4-methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxylate
SMILESCOC(=O)c1cc2c(C)ccnc2[nH]1
InChIInChI=1S/C10H10N2O2/c1-6-3-4-11-9-7(6)5-8(12-9)10(13)14-2/h3-5H,1-2H3,(H,11,12)
InChIKeyMORUICYTOYJQIQ-UHFFFAOYSA-N
XLogP1.66
TPSA54.98 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.20
LogP ≤ 51.66
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 4-methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxylate?
The IUPAC name of methyl 4-methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxylate (CID 71721167) is methyl 4-methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxylate.
What is the SMILES notation for methyl 4-methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxylate?
The canonical SMILES for methyl 4-methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxylate is COC(=O)c1cc2c(C)ccnc2[nH]1.
What is the InChIKey of methyl 4-methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxylate?
The InChIKey is MORUICYTOYJQIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2/c1-6-3-4-11-9-7(6)5-8(12-9)10(13)14-2/h3-5H,1-2H3,(H,11,12).
What are the key properties of methyl 4-methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxylate?
methyl 4-methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxylate has a molecular weight of 190.20 g/mol, XLogP of 1.66, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxylate is sourced from PubChem (CID 71721167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).