methyl 2,4-dimethylpyridine-3-carboxylate;hydrochloride

C9H12ClNO2 — CID 167762348

IUPACmethyl 2,4-dimethylpyridine-3-carboxylate;hydrochloride
SMILESCOC(=O)c1c(C)ccnc1C.Cl
InChIInChI=1S/C9H11NO2.ClH/c1-6-4-5-10-7(2)8(6)9(11)12-3;/h4-5H,1-3H3;1H
InChIKeyVZXKUZFAKBGWCS-UHFFFAOYSA-N
MW201.65 g/mol
LogP1.91
Rot. Bonds1

About methyl 2,4-dimethylpyridine-3-carboxylate;hydrochloride

methyl 2,4-dimethylpyridine-3-carboxylate;hydrochloride (PubChem CID 167762348) has the molecular formula C9H12ClNO2 and a molecular weight of 201.65 g/mol. Its IUPAC name is methyl 2,4-dimethylpyridine-3-carboxylate;hydrochloride.

Molecular Properties

Compound Namemethyl 2,4-dimethylpyridine-3-carboxylate;hydrochloride
PubChem CID167762348
Molecular FormulaC9H12ClNO2
Molecular Weight201.65 g/mol
Exact Mass201.06
IUPAC Namemethyl 2,4-dimethylpyridine-3-carboxylate;hydrochloride
SMILESCOC(=O)c1c(C)ccnc1C.Cl
InChIInChI=1S/C9H11NO2.ClH/c1-6-4-5-10-7(2)8(6)9(11)12-3;/h4-5H,1-3H3;1H
InChIKeyVZXKUZFAKBGWCS-UHFFFAOYSA-N
XLogP1.91
TPSA39.19 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500201.65
LogP ≤ 51.91
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 2,4-dimethylpyridine-3-carboxylate;hydrochloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2,4-dimethylpyridine-3-carboxylate;hydrochloride?
The IUPAC name of methyl 2,4-dimethylpyridine-3-carboxylate;hydrochloride (CID 167762348) is methyl 2,4-dimethylpyridine-3-carboxylate;hydrochloride.
What is the SMILES notation for methyl 2,4-dimethylpyridine-3-carboxylate;hydrochloride?
The canonical SMILES for methyl 2,4-dimethylpyridine-3-carboxylate;hydrochloride is COC(=O)c1c(C)ccnc1C.Cl.
What is the InChIKey of methyl 2,4-dimethylpyridine-3-carboxylate;hydrochloride?
The InChIKey is VZXKUZFAKBGWCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2.ClH/c1-6-4-5-10-7(2)8(6)9(11)12-3;/h4-5H,1-3H3;1H.
What are the key properties of methyl 2,4-dimethylpyridine-3-carboxylate;hydrochloride?
methyl 2,4-dimethylpyridine-3-carboxylate;hydrochloride has a molecular weight of 201.65 g/mol, XLogP of 1.91, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,4-dimethylpyridine-3-carboxylate;hydrochloride is sourced from PubChem (CID 167762348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).