C14H10BrF2NO2 — CID 86710363
methyl 4-(4-bromo-2,3-difluorophenyl)-2-methylpyridine-3-carboxylate (PubChem CID 86710363) has the molecular formula C14H10BrF2NO2 and a molecular weight of 342.14 g/mol. Its IUPAC name is methyl 4-(4-bromo-2,3-difluorophenyl)-2-methylpyridine-3-carboxylate.
| Compound Name | methyl 4-(4-bromo-2,3-difluorophenyl)-2-methylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 86710363 |
| Molecular Formula | C14H10BrF2NO2 |
| Molecular Weight | 342.14 g/mol |
| Exact Mass | 340.99 |
| IUPAC Name | methyl 4-(4-bromo-2,3-difluorophenyl)-2-methylpyridine-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(Br)c(F)c2F)ccnc1C |
| InChI | InChI=1S/C14H10BrF2NO2/c1-7-11(14(19)20-2)8(5-6-18-7)9-3-4-10(15)13(17)12(9)16/h3-6H,1-2H3 |
| InChIKey | SCWGSNUOHBJDNJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.14 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|