C11H16N2O4 — CID 142079616
ethane;(4Z,5Z)-4-ethylidene-5-(1-nitroethylidene)-1H-pyrrole-2-carboxylic acid (PubChem CID 142079616) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is ethane;(4Z,5Z)-4-ethylidene-5-(1-nitroethylidene)-1H-pyrrole-2-carboxylic acid.
| Compound Name | ethane;(4Z,5Z)-4-ethylidene-5-(1-nitroethylidene)-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 142079616 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | ethane;(4Z,5Z)-4-ethylidene-5-(1-nitroethylidene)-1H-pyrrole-2-carboxylic acid |
| SMILES | C/C=c1/cc(C(=O)O)[nH]/c1=C(/C)[N+](=O)[O-].CC |
| InChI | InChI=1S/C9H10N2O4.C2H6/c1-3-6-4-7(9(12)13)10-8(6)5(2)11(14)15;1-2/h3-4,10H,1-2H3,(H,12,13);1-2H3/b6-3-,8-5-; |
| InChIKey | BOVUSSBIGQLGCD-KWTPIRBXSA-N |
| XLogP | 0.94 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|