C14H13F3O — CID 143192920
2-[(3E)-hexa-1,3,5-trien-3-yl]-4-methyl-1-(trifluoromethoxy)benzene (PubChem CID 143192920) has the molecular formula C14H13F3O and a molecular weight of 254.25 g/mol. Its IUPAC name is 2-[(3E)-hexa-1,3,5-trien-3-yl]-4-methyl-1-(trifluoromethoxy)benzene.
| Compound Name | 2-[(3E)-hexa-1,3,5-trien-3-yl]-4-methyl-1-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 143192920 |
| Molecular Formula | C14H13F3O |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 2-[(3E)-hexa-1,3,5-trien-3-yl]-4-methyl-1-(trifluoromethoxy)benzene |
| SMILES | C=C/C=C(\C=C)c1cc(C)ccc1OC(F)(F)F |
| InChI | InChI=1S/C14H13F3O/c1-4-6-11(5-2)12-9-10(3)7-8-13(12)18-14(15,16)17/h4-9H,1-2H2,3H3/b11-6+ |
| InChIKey | UJJZPLSNHHWEFH-IZZDOVSWSA-N |
| XLogP | 4.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|