C12H14N2O — CID 145300171
5-[(3E,5Z,7Z)-nona-1,3,5,7-tetraen-4-yl]-1,2-dihydropyrazol-3-one (PubChem CID 145300171) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is 5-[(3E,5Z,7Z)-nona-1,3,5,7-tetraen-4-yl]-1,2-dihydropyrazol-3-one.
| Compound Name | 5-[(3E,5Z,7Z)-nona-1,3,5,7-tetraen-4-yl]-1,2-dihydropyrazol-3-one |
|---|---|
| PubChem CID | 145300171 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 5-[(3E,5Z,7Z)-nona-1,3,5,7-tetraen-4-yl]-1,2-dihydropyrazol-3-one |
| SMILES | C=C/C=C(\C=C/C=C\C)c1cc(=O)[nH][nH]1 |
| InChI | InChI=1S/C12H14N2O/c1-3-5-6-8-10(7-4-2)11-9-12(15)14-13-11/h3-9H,2H2,1H3,(H2,13,14,15)/b5-3-,8-6-,10-7+ |
| InChIKey | FYJZJHJSUKBRHO-GSKGFLMHSA-N |
| XLogP | 2.40 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|