C15H19NOS — CID 143790618
formaldehyde;3-methyl-4-[(3E,5Z,7Z)-nona-1,3,5,7-tetraen-4-yl]thiophen-2-amine (PubChem CID 143790618) has the molecular formula C15H19NOS and a molecular weight of 261.39 g/mol. Its IUPAC name is formaldehyde;3-methyl-4-[(3E,5Z,7Z)-nona-1,3,5,7-tetraen-4-yl]thiophen-2-amine.
| Compound Name | formaldehyde;3-methyl-4-[(3E,5Z,7Z)-nona-1,3,5,7-tetraen-4-yl]thiophen-2-amine |
|---|---|
| PubChem CID | 143790618 |
| Molecular Formula | C15H19NOS |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | formaldehyde;3-methyl-4-[(3E,5Z,7Z)-nona-1,3,5,7-tetraen-4-yl]thiophen-2-amine |
| SMILES | C=C/C=C(\C=C/C=C\C)c1csc(N)c1C.C=O |
| InChI | InChI=1S/C14H17NS.CH2O/c1-4-6-7-9-12(8-5-2)13-10-16-14(15)11(13)3;1-2/h4-10H,2,15H2,1,3H3;1H2/b6-4-,9-7-,12-8+; |
| InChIKey | TVEDYUFPXXFDKG-SKQJUMRXSA-N |
| XLogP | 4.16 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|