C18H17NOS — CID 143790626
(2E)-1-(2-amino-4-phenylthiophen-3-yl)-2-[(Z)-prop-1-enyl]penta-2,4-dien-1-one (PubChem CID 143790626) has the molecular formula C18H17NOS and a molecular weight of 295.41 g/mol. Its IUPAC name is (2E)-1-(2-amino-4-phenylthiophen-3-yl)-2-[(Z)-prop-1-enyl]penta-2,4-dien-1-one.
| Compound Name | (2E)-1-(2-amino-4-phenylthiophen-3-yl)-2-[(Z)-prop-1-enyl]penta-2,4-dien-1-one |
|---|---|
| PubChem CID | 143790626 |
| Molecular Formula | C18H17NOS |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | (2E)-1-(2-amino-4-phenylthiophen-3-yl)-2-[(Z)-prop-1-enyl]penta-2,4-dien-1-one |
| SMILES | C=C/C=C(\C=C/C)C(=O)c1c(-c2ccccc2)csc1N |
| InChI | InChI=1S/C18H17NOS/c1-3-8-14(9-4-2)17(20)16-15(12-21-18(16)19)13-10-6-5-7-11-13/h3-12H,1,19H2,2H3/b9-4-,14-8+ |
| InChIKey | MNLHUQYKDRKZBQ-MPIKLPQRSA-N |
| XLogP | 4.87 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|