C16H20O3 — CID 145367906
ethane;5-[(3E)-hexa-1,3,5-trien-3-yl]-2,3-dihydroxy-6-methylcyclohepta-2,4,6-trien-1-one (PubChem CID 145367906) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is ethane;5-[(3E)-hexa-1,3,5-trien-3-yl]-2,3-dihydroxy-6-methylcyclohepta-2,4,6-trien-1-one.
| Compound Name | ethane;5-[(3E)-hexa-1,3,5-trien-3-yl]-2,3-dihydroxy-6-methylcyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 145367906 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | ethane;5-[(3E)-hexa-1,3,5-trien-3-yl]-2,3-dihydroxy-6-methylcyclohepta-2,4,6-trien-1-one |
| SMILES | C=C/C=C(\C=C)c1cc(O)c(O)c(=O)cc1C.CC |
| InChI | InChI=1S/C14H14O3.C2H6/c1-4-6-10(5-2)11-8-13(16)14(17)12(15)7-9(11)3;1-2/h4-8H,1-2H2,3H3,(H2,15,16,17);1-2H3/b10-6+; |
| InChIKey | DTPHOESRKYSFSK-AAGWESIMSA-N |
| XLogP | 3.55 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|