C18H20O5 — CID 177001547
2-[(3E)-hexa-1,3,5-trien-3-yl]-5,6,7-trihydroxychromen-4-one;propane (PubChem CID 177001547) has the molecular formula C18H20O5 and a molecular weight of 316.35 g/mol. Its IUPAC name is 2-[(3E)-hexa-1,3,5-trien-3-yl]-5,6,7-trihydroxychromen-4-one;propane.
| Compound Name | 2-[(3E)-hexa-1,3,5-trien-3-yl]-5,6,7-trihydroxychromen-4-one;propane |
|---|---|
| PubChem CID | 177001547 |
| Molecular Formula | C18H20O5 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 2-[(3E)-hexa-1,3,5-trien-3-yl]-5,6,7-trihydroxychromen-4-one;propane |
| SMILES | C=C/C=C(\C=C)c1cc(=O)c2c(O)c(O)c(O)cc2o1.CCC |
| InChI | InChI=1S/C15H12O5.C3H8/c1-3-5-8(4-2)11-6-9(16)13-12(20-11)7-10(17)14(18)15(13)19;1-3-2/h3-7,17-19H,1-2H2;3H2,1-2H3/b8-5+; |
| InChIKey | ZLRSWIPNMFJRMP-HAAWTFQLSA-N |
| XLogP | 4.08 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|