C15H10O6 — CID 87586678
5,6,7-trihydroxy-2-(4-oxocyclohexa-1,5-dien-1-yl)chromen-4-one (PubChem CID 87586678) has the molecular formula C15H10O6 and a molecular weight of 286.24 g/mol. Its IUPAC name is 5,6,7-trihydroxy-2-(4-oxocyclohexa-1,5-dien-1-yl)chromen-4-one.
| Compound Name | 5,6,7-trihydroxy-2-(4-oxocyclohexa-1,5-dien-1-yl)chromen-4-one |
|---|---|
| PubChem CID | 87586678 |
| Molecular Formula | C15H10O6 |
| Molecular Weight | 286.24 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 5,6,7-trihydroxy-2-(4-oxocyclohexa-1,5-dien-1-yl)chromen-4-one |
| SMILES | O=C1C=CC(c2cc(=O)c3c(O)c(O)c(O)cc3o2)=CC1 |
| InChI | InChI=1S/C15H10O6/c16-8-3-1-7(2-4-8)11-5-9(17)13-12(21-11)6-10(18)14(19)15(13)20/h1-3,5-6,18-20H,4H2 |
| InChIKey | KTRZDIZXKPKFDW-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.24 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|