C15H14N2O — CID 11118116
2,10-diazatricyclo[11.4.0.03,8]heptadeca-1(17),3,5,7,13,15-hexaen-9-one (PubChem CID 11118116) has the molecular formula C15H14N2O and a molecular weight of 238.29 g/mol. Its IUPAC name is 2,10-diazatricyclo[11.4.0.03,8]heptadeca-1(17),3,5,7,13,15-hexaen-9-one.
| Compound Name | 2,10-diazatricyclo[11.4.0.03,8]heptadeca-1(17),3,5,7,13,15-hexaen-9-one |
|---|---|
| PubChem CID | 11118116 |
| Molecular Formula | C15H14N2O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 2,10-diazatricyclo[11.4.0.03,8]heptadeca-1(17),3,5,7,13,15-hexaen-9-one |
| SMILES | O=C1NCCc2ccccc2Nc2ccccc21 |
| InChI | InChI=1S/C15H14N2O/c18-15-12-6-2-4-8-14(12)17-13-7-3-1-5-11(13)9-10-16-15/h1-8,17H,9-10H2,(H,16,18) |
| InChIKey | LMKZGVAERHZHLF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |