About 6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isophosphinoline 2-oxide
6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isophosphinoline 2-oxide (PubChem CID 13356972) has the molecular formula C12H17O3P
and a molecular weight of 240.24 g/mol. Its IUPAC name is 6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isophosphinoline 2-oxide.
Molecular Properties
| Compound Name | 6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isophosphinoline 2-oxide |
| PubChem CID | 13356972 |
| Molecular Formula | C12H17O3P |
| Molecular Weight | 240.24 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isophosphinoline 2-oxide |
| SMILES | COc1cc2c(cc1OC)CP(C)(=O)CC2 |
| InChI | InChI=1S/C12H17O3P/c1-14-11-6-9-4-5-16(3,13)8-10(9)7-12(11)15-2/h6-7H,4-5,8H2,1-3H3 |
| InChIKey | OLEOCMNNFNYNSS-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.24 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isophosphinoline 2-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isophosphinoline 2-oxide?
The IUPAC name of 6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isophosphinoline 2-oxide (CID 13356972) is 6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isophosphinoline 2-oxide.
What is the SMILES notation for 6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isophosphinoline 2-oxide?
The canonical SMILES for 6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isophosphinoline 2-oxide is COc1cc2c(cc1OC)CP(C)(=O)CC2.
What is the InChIKey of 6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isophosphinoline 2-oxide?
The InChIKey is OLEOCMNNFNYNSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17O3P/c1-14-11-6-9-4-5-16(3,13)8-10(9)7-12(11)15-2/h6-7H,4-5,8H2,1-3H3.
What are the key properties of 6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isophosphinoline 2-oxide?
6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isophosphinoline 2-oxide has a molecular weight of 240.24 g/mol, XLogP of 2.75, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isophosphinoline 2-oxide is sourced from PubChem (CID 13356972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).